C17H16N6O — CID 59723201
2-[2-(2-amino-6-methylphenyl)pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 59723201) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[2-(2-amino-6-methylphenyl)pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2-[2-(2-amino-6-methylphenyl)pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 59723201 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[2-(2-amino-6-methylphenyl)pyrimidin-4-yl]-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | Cc1cccc(N)c1-c1nccc(-c2cc3n(n2)CCNC3=O)n1 |
| InChI | InChI=1S/C17H16N6O/c1-10-3-2-4-11(18)15(10)16-19-6-5-12(21-16)13-9-14-17(24)20-7-8-23(14)22-13/h2-6,9H,7-8,18H2,1H3,(H,20,24) |
| InChIKey | SWFUEAMLYCKVOA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|