C8H10N2O3 — CID 59723669
5-ethenyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 59723669) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 5-ethenyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethenyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59723669 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 5-ethenyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CC1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C8H10N2O3/c1-4-5-6(11)9(2)8(13)10(3)7(5)12/h4-5H,1H2,2-3H3 |
| InChIKey | APYPLVSLKWYBOD-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|