C30H32F2N6O3 — CID 59724019
2-[4-[2-(3,3-difluoropiperidin-1-yl)ethyl]anilino]-8-(4-ethylphenyl)-N-methoxy-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59724019) has the molecular formula C30H32F2N6O3 and a molecular weight of 562.62 g/mol. Its IUPAC name is 2-[4-[2-(3,3-difluoropiperidin-1-yl)ethyl]anilino]-8-(4-ethylphenyl)-N-methoxy-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-[4-[2-(3,3-difluoropiperidin-1-yl)ethyl]anilino]-8-(4-ethylphenyl)-N-methoxy-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59724019 |
| Molecular Formula | C30H32F2N6O3 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 2-[4-[2-(3,3-difluoropiperidin-1-yl)ethyl]anilino]-8-(4-ethylphenyl)-N-methoxy-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCc1ccc(-n2cc(C(=O)NOC)c(=O)c3cnc(Nc4ccc(CCN5CCCC(F)(F)C5)cc4)nc32)cc1 |
| InChI | InChI=1S/C30H32F2N6O3/c1-3-20-7-11-23(12-8-20)38-18-25(28(40)36-41-2)26(39)24-17-33-29(35-27(24)38)34-22-9-5-21(6-10-22)13-16-37-15-4-14-30(31,32)19-37/h5-12,17-18H,3-4,13-16,19H2,1-2H3,(H,36,40)(H,33,34,35) |
| InChIKey | JVGDZYKCBMHORS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|