C28H27F3N6O3 — CID 59724032
N-methoxy-2-[4-(1-methylpiperidin-4-yl)anilino]-5-oxo-8-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59724032) has the molecular formula C28H27F3N6O3 and a molecular weight of 552.56 g/mol. Its IUPAC name is N-methoxy-2-[4-(1-methylpiperidin-4-yl)anilino]-5-oxo-8-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-methoxy-2-[4-(1-methylpiperidin-4-yl)anilino]-5-oxo-8-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59724032 |
| Molecular Formula | C28H27F3N6O3 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | N-methoxy-2-[4-(1-methylpiperidin-4-yl)anilino]-5-oxo-8-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CONC(=O)c1cn(-c2ccc(C(F)(F)F)cc2)c2nc(Nc3ccc(C4CCN(C)CC4)cc3)ncc2c1=O |
| InChI | InChI=1S/C28H27F3N6O3/c1-36-13-11-18(12-14-36)17-3-7-20(8-4-17)33-27-32-15-22-24(38)23(26(39)35-40-2)16-37(25(22)34-27)21-9-5-19(6-10-21)28(29,30)31/h3-10,15-16,18H,11-14H2,1-2H3,(H,35,39)(H,32,33,34) |
| InChIKey | USXOFUUORGEQKS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|