C32H31F5N6O3 — CID 59724087
8-(2,3-dihydro-1H-inden-5-yl)-N-methoxy-5-oxo-2-[3-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]anilino]pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59724087) has the molecular formula C32H31F5N6O3 and a molecular weight of 642.63 g/mol. Its IUPAC name is 8-(2,3-dihydro-1H-inden-5-yl)-N-methoxy-5-oxo-2-[3-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]anilino]pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 8-(2,3-dihydro-1H-inden-5-yl)-N-methoxy-5-oxo-2-[3-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]anilino]pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59724087 |
| Molecular Formula | C32H31F5N6O3 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 8-(2,3-dihydro-1H-inden-5-yl)-N-methoxy-5-oxo-2-[3-[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]anilino]pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CONC(=O)c1cn(-c2ccc3c(c2)CCC3)c2nc(Nc3cccc(C4CCN(CC(F)(F)C(F)(F)F)CC4)c3)ncc2c1=O |
| InChI | InChI=1S/C32H31F5N6O3/c1-46-41-29(45)26-17-43(24-9-8-19-4-2-5-22(19)15-24)28-25(27(26)44)16-38-30(40-28)39-23-7-3-6-21(14-23)20-10-12-42(13-11-20)18-31(33,34)32(35,36)37/h3,6-9,14-17,20H,2,4-5,10-13,18H2,1H3,(H,41,45)(H,38,39,40) |
| InChIKey | VXXLRKRVQFIFSI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|