C31H33F3N6O3 — CID 59724156
N-ethoxy-8-(4-ethylphenyl)-5-oxo-2-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]anilino]pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59724156) has the molecular formula C31H33F3N6O3 and a molecular weight of 594.64 g/mol. Its IUPAC name is N-ethoxy-8-(4-ethylphenyl)-5-oxo-2-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]anilino]pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-ethoxy-8-(4-ethylphenyl)-5-oxo-2-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]anilino]pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59724156 |
| Molecular Formula | C31H33F3N6O3 |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | N-ethoxy-8-(4-ethylphenyl)-5-oxo-2-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]anilino]pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCONC(=O)c1cn(-c2ccc(CC)cc2)c2nc(Nc3ccc(C4CCN(CC(F)(F)F)CC4)cc3)ncc2c1=O |
| InChI | InChI=1S/C31H33F3N6O3/c1-3-20-5-11-24(12-6-20)40-18-26(29(42)38-43-4-2)27(41)25-17-35-30(37-28(25)40)36-23-9-7-21(8-10-23)22-13-15-39(16-14-22)19-31(32,33)34/h5-12,17-18,22H,3-4,13-16,19H2,1-2H3,(H,38,42)(H,35,36,37) |
| InChIKey | HACKSGUVVPFKHC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|