C29H29F3N6O3 — CID 59724159
2-[4-(1-ethylpiperidin-4-yl)anilino]-N-methoxy-5-oxo-8-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59724159) has the molecular formula C29H29F3N6O3 and a molecular weight of 566.58 g/mol. Its IUPAC name is 2-[4-(1-ethylpiperidin-4-yl)anilino]-N-methoxy-5-oxo-8-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-[4-(1-ethylpiperidin-4-yl)anilino]-N-methoxy-5-oxo-8-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59724159 |
| Molecular Formula | C29H29F3N6O3 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-[4-(1-ethylpiperidin-4-yl)anilino]-N-methoxy-5-oxo-8-[4-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCN1CCC(c2ccc(Nc3ncc4c(=O)c(C(=O)NOC)cn(-c5ccc(C(F)(F)F)cc5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C29H29F3N6O3/c1-3-37-14-12-19(13-15-37)18-4-8-21(9-5-18)34-28-33-16-23-25(39)24(27(40)36-41-2)17-38(26(23)35-28)22-10-6-20(7-11-22)29(30,31)32/h4-11,16-17,19H,3,12-15H2,1-2H3,(H,36,40)(H,33,34,35) |
| InChIKey | WOJHURBFQJTHSM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|