C15H11BrF4O4S — CID 59724353
(4-methylphenyl) 2-(4-bromophenoxy)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 59724353) has the molecular formula C15H11BrF4O4S and a molecular weight of 443.21 g/mol. Its IUPAC name is (4-methylphenyl) 2-(4-bromophenoxy)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | (4-methylphenyl) 2-(4-bromophenoxy)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 59724353 |
| Molecular Formula | C15H11BrF4O4S |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | (4-methylphenyl) 2-(4-bromophenoxy)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)Oc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C15H11BrF4O4S/c1-10-2-6-13(7-3-10)24-25(21,22)15(19,20)14(17,18)23-12-8-4-11(16)5-9-12/h2-9H,1H3 |
| InChIKey | OXSSLEWJZQUITD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|