C24H15F7O8S — CID 59724380
4-[1-(4-carboxyphenyl)-2,2,2-trifluoro-1-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]ethyl]benzoic acid (PubChem CID 59724380) has the molecular formula C24H15F7O8S and a molecular weight of 596.43 g/mol. Its IUPAC name is 4-[1-(4-carboxyphenyl)-2,2,2-trifluoro-1-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]ethyl]benzoic acid.
| Compound Name | 4-[1-(4-carboxyphenyl)-2,2,2-trifluoro-1-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 59724380 |
| Molecular Formula | C24H15F7O8S |
| Molecular Weight | 596.43 g/mol |
| Exact Mass | 596.04 |
| IUPAC Name | 4-[1-(4-carboxyphenyl)-2,2,2-trifluoro-1-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(c2ccc(OC(F)(F)C(F)(F)S(=O)(=O)O)cc2)(c2ccc(C(=O)O)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H15F7O8S/c25-22(26,27)21(15-5-1-13(2-6-15)19(32)33,16-7-3-14(4-8-16)20(34)35)17-9-11-18(12-10-17)39-23(28,29)24(30,31)40(36,37)38/h1-12H,(H,32,33)(H,34,35)(H,36,37,38) |
| InChIKey | JKCYCONNTUUKKB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|