C30H22F4O4S — CID 59724384
1,1,2,2-tetrafluoro-2-[(2',6,7'-trimethyl-9,9'-spirobi[fluorene]-3-yl)oxy]ethanesulfonic acid (PubChem CID 59724384) has the molecular formula C30H22F4O4S and a molecular weight of 554.56 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[(2',6,7'-trimethyl-9,9'-spirobi[fluorene]-3-yl)oxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[(2',6,7'-trimethyl-9,9'-spirobi[fluorene]-3-yl)oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 59724384 |
| Molecular Formula | C30H22F4O4S |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[(2',6,7'-trimethyl-9,9'-spirobi[fluorene]-3-yl)oxy]ethanesulfonic acid |
| SMILES | Cc1ccc2c(c1)-c1cc(OC(F)(F)C(F)(F)S(=O)(=O)O)ccc1C21c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C30H22F4O4S/c1-16-6-10-24-22(12-16)23-15-19(38-29(31,32)30(33,34)39(35,36)37)7-11-25(23)28(24)26-13-17(2)4-8-20(26)21-9-5-18(3)14-27(21)28/h4-15H,1-3H3,(H,35,36,37) |
| InChIKey | VDYOXSXSEMZIPD-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|