C28H19F7O7S2 — CID 59724391
1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethanesulfonic acid (PubChem CID 59724391) has the molecular formula C28H19F7O7S2 and a molecular weight of 664.57 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethanesulfonic acid |
|---|---|
| PubChem CID | 59724391 |
| Molecular Formula | C28H19F7O7S2 |
| Molecular Weight | 664.57 g/mol |
| Exact Mass | 664.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)S(=O)(=O)c1ccc(-c2ccc(C(c3ccc(O)cc3)(c3ccc(O)cc3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H19F7O7S2/c29-26(30,31)25(20-7-11-22(36)12-8-20,21-9-13-23(37)14-10-21)19-5-1-17(2-6-19)18-3-15-24(16-4-18)43(38,39)27(32,33)28(34,35)44(40,41)42/h1-16,36-37H,(H,40,41,42) |
| InChIKey | SUVNDTFLZBFQPB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|