C29H20F8O10S2 — CID 59724396
2-[4-[bis(4-hydroxyphenyl)-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]methyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 59724396) has the molecular formula C29H20F8O10S2 and a molecular weight of 744.59 g/mol. Its IUPAC name is 2-[4-[bis(4-hydroxyphenyl)-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]methyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[4-[bis(4-hydroxyphenyl)-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]methyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 59724396 |
| Molecular Formula | C29H20F8O10S2 |
| Molecular Weight | 744.59 g/mol |
| Exact Mass | 744.04 |
| IUPAC Name | 2-[4-[bis(4-hydroxyphenyl)-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]methyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)Oc1ccc(C(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccc(OC(F)(F)C(F)(F)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H20F8O10S2/c30-26(31,28(34,35)48(40,41)42)46-23-13-5-19(6-14-23)25(17-1-9-21(38)10-2-17,18-3-11-22(39)12-4-18)20-7-15-24(16-8-20)47-27(32,33)29(36,37)49(43,44)45/h1-16,38-39H,(H,40,41,42)(H,43,44,45) |
| InChIKey | KYZPKNAFKQULAQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|