C30H19F11O8S2 — CID 59724398
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethoxy]ethanesulfonic acid (PubChem CID 59724398) has the molecular formula C30H19F11O8S2 and a molecular weight of 780.59 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 59724398 |
| Molecular Formula | C30H19F11O8S2 |
| Molecular Weight | 780.59 g/mol |
| Exact Mass | 780.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[4-[2,2,2-trifluoro-1,1-bis(4-hydroxyphenyl)ethyl]phenyl]phenyl]sulfonylethoxy]ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)c1ccc(-c2ccc(C(c3ccc(O)cc3)(c3ccc(O)cc3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H19F11O8S2/c31-26(32,33)25(20-7-11-22(42)12-8-20,21-9-13-23(43)14-10-21)19-5-1-17(2-6-19)18-3-15-24(16-4-18)50(44,45)29(38,39)27(34,35)49-28(36,37)30(40,41)51(46,47)48/h1-16,42-43H,(H,46,47,48) |
| InChIKey | ISBLQHAWSIQXLB-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.59 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|