C24H18F8O6S — CID 59724403
2-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 59724403) has the molecular formula C24H18F8O6S and a molecular weight of 586.45 g/mol. Its IUPAC name is 2-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 59724403 |
| Molecular Formula | C24H18F8O6S |
| Molecular Weight | 586.45 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | 2-[2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenyl]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C24H18F8O6S/c1-20(15-6-10-18(33)11-7-15,16-8-12-19(34)13-9-16)14-2-4-17(5-3-14)21(25,26)22(27,28)38-23(29,30)24(31,32)39(35,36)37/h2-13,33-34H,1H3,(H,35,36,37) |
| InChIKey | HPUGPHWYLGFNKR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|