C21H15N3 — CID 59724442
3-phenyl-5-(6-pyridin-2-yl-3-pyridinyl)pyridine (PubChem CID 59724442) has the molecular formula C21H15N3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-phenyl-5-(6-pyridin-2-yl-3-pyridinyl)pyridine.
| Compound Name | 3-phenyl-5-(6-pyridin-2-yl-3-pyridinyl)pyridine |
|---|---|
| PubChem CID | 59724442 |
| Molecular Formula | C21H15N3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-phenyl-5-(6-pyridin-2-yl-3-pyridinyl)pyridine |
| SMILES | c1ccc(-c2cncc(-c3ccc(-c4ccccn4)nc3)c2)cc1 |
| InChI | InChI=1S/C21H15N3/c1-2-6-16(7-3-1)18-12-19(14-22-13-18)17-9-10-21(24-15-17)20-8-4-5-11-23-20/h1-15H |
| InChIKey | QERQVUQAFGVBGB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |