C21H31BrFNO5Si — CID 59724578
(3R,3aR,4S,6aS)-1-[(3-bromo-6-fluoro-2-methoxyphenyl)methyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 59724578) has the molecular formula C21H31BrFNO5Si and a molecular weight of 504.47 g/mol. Its IUPAC name is (3R,3aR,4S,6aS)-1-[(3-bromo-6-fluoro-2-methoxyphenyl)methyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3R,3aR,4S,6aS)-1-[(3-bromo-6-fluoro-2-methoxyphenyl)methyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 59724578 |
| Molecular Formula | C21H31BrFNO5Si |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | (3R,3aR,4S,6aS)-1-[(3-bromo-6-fluoro-2-methoxyphenyl)methyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | COc1c(Br)ccc(F)c1CN1O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]2[C@H](C)OC(=O)[C@H]21 |
| InChI | InChI=1S/C21H31BrFNO5Si/c1-12-17-16(11-27-30(6,7)21(2,3)4)29-24(18(17)20(25)28-12)10-13-15(23)9-8-14(22)19(13)26-5/h8-9,12,16-18H,10-11H2,1-7H3/t12-,16-,17+,18-/m0/s1 |
| InChIKey | AYMLJXFGLFPUER-BIMQEMHKSA-N |
| XLogP | 4.66 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|