C15H20INO5 — CID 59725155
(3R,3aR,4S,6aS)-3-(hydroxymethyl)-1-[(2Z,4E)-4-iodo-3-methoxyhepta-2,4,6-trienyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 59725155) has the molecular formula C15H20INO5 and a molecular weight of 421.23 g/mol. Its IUPAC name is (3R,3aR,4S,6aS)-3-(hydroxymethyl)-1-[(2Z,4E)-4-iodo-3-methoxyhepta-2,4,6-trienyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3R,3aR,4S,6aS)-3-(hydroxymethyl)-1-[(2Z,4E)-4-iodo-3-methoxyhepta-2,4,6-trienyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 59725155 |
| Molecular Formula | C15H20INO5 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | (3R,3aR,4S,6aS)-3-(hydroxymethyl)-1-[(2Z,4E)-4-iodo-3-methoxyhepta-2,4,6-trienyl]-4-methyl-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | C=C/C=C(I)\C(=C\CN1O[C@@H](CO)[C@H]2[C@H](C)OC(=O)[C@H]21)OC |
| InChI | InChI=1S/C15H20INO5/c1-4-5-10(16)11(20-3)6-7-17-14-13(12(8-18)22-17)9(2)21-15(14)19/h4-6,9,12-14,18H,1,7-8H2,2-3H3/b10-5+,11-6-/t9-,12-,13+,14-/m0/s1 |
| InChIKey | KWMFUDUFPLDSBZ-DVZXKOOQSA-N |
| XLogP | 1.56 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|