About 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine
2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine (PubChem CID 59725331) has the molecular formula C38H24F6N2
and a molecular weight of 622.61 g/mol. Its IUPAC name is 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine.
Molecular Properties
| Compound Name | 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine |
| PubChem CID | 59725331 |
| Molecular Formula | C38H24F6N2 |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine |
| SMILES | CC1(C(F)(F)F)c2ccccc2-c2ccc(-c3ccc4nc(-c5ccc6c(c5)C(C)(C(F)(F)F)c5ccccc5-6)ccc4n3)cc21 |
| InChI | InChI=1S/C38H24F6N2/c1-35(37(39,40)41)27-9-5-3-7-23(27)25-13-11-21(19-29(25)35)31-15-17-34-33(45-31)18-16-32(46-34)22-12-14-26-24-8-4-6-10-28(24)36(2,30(26)20-22)38(42,43)44/h3-20H,1-2H3 |
| InChIKey | QMVCNLSAEYPEQZ-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine?
The IUPAC name of 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine (CID 59725331) is 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine.
What is the SMILES notation for 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine?
The canonical SMILES for 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine is CC1(C(F)(F)F)c2ccccc2-c2ccc(-c3ccc4nc(-c5ccc6c(c5)C(C)(C(F)(F)F)c5ccccc5-6)ccc4n3)cc21.
What is the InChIKey of 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine?
The InChIKey is QMVCNLSAEYPEQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H24F6N2/c1-35(37(39,40)41)27-9-5-3-7-23(27)25-13-11-21(19-29(25)35)31-15-17-34-33(45-31)18-16-32(46-34)22-12-14-26-24-8-4-6-10-28(24)36(2,30(26)20-22)38(42,43)44/h3-20H,1-2H3.
What are the key properties of 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine?
2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine has a molecular weight of 622.61 g/mol, XLogP of 10.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[9-methyl-9-(trifluoromethyl)fluoren-2-yl]-1,5-naphthyridine is sourced from PubChem (CID 59725331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).