C14H22N2O3 — CID 59725815
1-(1,5-dimethylimidazol-4-yl)-4-(oxan-2-yloxy)butan-1-one (PubChem CID 59725815) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(1,5-dimethylimidazol-4-yl)-4-(oxan-2-yloxy)butan-1-one.
| Compound Name | 1-(1,5-dimethylimidazol-4-yl)-4-(oxan-2-yloxy)butan-1-one |
|---|---|
| PubChem CID | 59725815 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-(1,5-dimethylimidazol-4-yl)-4-(oxan-2-yloxy)butan-1-one |
| SMILES | Cc1c(C(=O)CCCOC2CCCCO2)ncn1C |
| InChI | InChI=1S/C14H22N2O3/c1-11-14(15-10-16(11)2)12(17)6-5-9-19-13-7-3-4-8-18-13/h10,13H,3-9H2,1-2H3 |
| InChIKey | KWLWWGXYDAPRNV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|