C23H15F2N7O2 — CID 59726887
9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)-7-methylpurin-8-one (PubChem CID 59726887) has the molecular formula C23H15F2N7O2 and a molecular weight of 459.42 g/mol. Its IUPAC name is 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)-7-methylpurin-8-one.
| Compound Name | 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)-7-methylpurin-8-one |
|---|---|
| PubChem CID | 59726887 |
| Molecular Formula | C23H15F2N7O2 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)-7-methylpurin-8-one |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4c(n3)n(C3CCOc5c(F)cc(F)cc53)c(=O)n4C)c2c1 |
| InChI | InChI=1S/C23H15F2N7O2/c1-26-13-3-4-16-18(9-13)31(11-28-16)22-27-10-19-21(29-22)32(23(33)30(19)2)17-5-6-34-20-14(17)7-12(24)8-15(20)25/h3-4,7-11,17H,5-6H2,2H3 |
| InChIKey | FJGICXQMEBVHMN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|