C30H25F2N7O4 — CID 59726894
9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-[2-[(2,4-dimethoxyphenyl)methylamino]-5-isocyanoanilino]-7H-purin-8-one (PubChem CID 59726894) has the molecular formula C30H25F2N7O4 and a molecular weight of 585.57 g/mol. Its IUPAC name is 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-[2-[(2,4-dimethoxyphenyl)methylamino]-5-isocyanoanilino]-7H-purin-8-one.
| Compound Name | 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-[2-[(2,4-dimethoxyphenyl)methylamino]-5-isocyanoanilino]-7H-purin-8-one |
|---|---|
| PubChem CID | 59726894 |
| Molecular Formula | C30H25F2N7O4 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | 9-(6,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-[2-[(2,4-dimethoxyphenyl)methylamino]-5-isocyanoanilino]-7H-purin-8-one |
| SMILES | [C-]#[N+]c1ccc(NCc2ccc(OC)cc2OC)c(Nc2ncc3[nH]c(=O)n(C4CCOc5c(F)cc(F)cc54)c3n2)c1 |
| InChI | InChI=1S/C30H25F2N7O4/c1-33-18-5-7-22(34-14-16-4-6-19(41-2)13-26(16)42-3)23(12-18)36-29-35-15-24-28(38-29)39(30(40)37-24)25-8-9-43-27-20(25)10-17(31)11-21(27)32/h4-7,10-13,15,25,34H,8-9,14H2,2-3H3,(H,37,40)(H,35,36,38) |
| InChIKey | BYJNXGMIFAMARY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|