C25H17F2N7O4 — CID 59726909
methyl 2-[9-[(4R)-6,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-8-oxopurin-7-yl]acetate (PubChem CID 59726909) has the molecular formula C25H17F2N7O4 and a molecular weight of 517.45 g/mol. Its IUPAC name is methyl 2-[9-[(4R)-6,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-8-oxopurin-7-yl]acetate.
| Compound Name | methyl 2-[9-[(4R)-6,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-8-oxopurin-7-yl]acetate |
|---|---|
| PubChem CID | 59726909 |
| Molecular Formula | C25H17F2N7O4 |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | methyl 2-[9-[(4R)-6,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-8-oxopurin-7-yl]acetate |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4c(n3)n([C@@H]3CCOc5c(F)cc(F)cc53)c(=O)n4CC(=O)OC)c2c1 |
| InChI | InChI=1S/C25H17F2N7O4/c1-28-14-3-4-17-19(9-14)33(12-30-17)24-29-10-20-23(31-24)34(25(36)32(20)11-21(35)37-2)18-5-6-38-22-15(18)7-13(26)8-16(22)27/h3-4,7-10,12,18H,5-6,11H2,2H3/t18-/m1/s1 |
| InChIKey | TYZXCNVSHYGEKQ-GOSISDBHSA-N |
| XLogP | 3.31 |
| TPSA | 110.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|