C25H22F3N7O2 — CID 59726917
9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-fluorobenzimidazol-1-yl)-7-[3-(methylamino)propyl]purin-8-one (PubChem CID 59726917) has the molecular formula C25H22F3N7O2 and a molecular weight of 509.49 g/mol. Its IUPAC name is 9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-fluorobenzimidazol-1-yl)-7-[3-(methylamino)propyl]purin-8-one.
| Compound Name | 9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-fluorobenzimidazol-1-yl)-7-[3-(methylamino)propyl]purin-8-one |
|---|---|
| PubChem CID | 59726917 |
| Molecular Formula | C25H22F3N7O2 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-fluorobenzimidazol-1-yl)-7-[3-(methylamino)propyl]purin-8-one |
| SMILES | CNCCCn1c(=O)n([C@@H]2CCOc3c(F)ccc(F)c32)c2nc(-n3cnc4ccc(F)cc43)ncc21 |
| InChI | InChI=1S/C25H22F3N7O2/c1-29-8-2-9-33-20-12-30-24(34-13-31-17-6-3-14(26)11-19(17)34)32-23(20)35(25(33)36)18-7-10-37-22-16(28)5-4-15(27)21(18)22/h3-6,11-13,18,29H,2,7-10H2,1H3/t18-/m1/s1 |
| InChIKey | YVFNLFUOQHRZES-GOSISDBHSA-N |
| XLogP | 3.33 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|