C28H19F2N8O3+ — CID 59726922
3-[9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-7-[(1-hydroxypyridin-1-ium-4-yl)methyl]-8-oxopurin-2-yl]benzimidazole-5-carbonitrile (PubChem CID 59726922) has the molecular formula C28H19F2N8O3+ and a molecular weight of 553.51 g/mol. Its IUPAC name is 3-[9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-7-[(1-hydroxypyridin-1-ium-4-yl)methyl]-8-oxopurin-2-yl]benzimidazole-5-carbonitrile.
| Compound Name | 3-[9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-7-[(1-hydroxypyridin-1-ium-4-yl)methyl]-8-oxopurin-2-yl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 59726922 |
| Molecular Formula | C28H19F2N8O3+ |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 3-[9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-7-[(1-hydroxypyridin-1-ium-4-yl)methyl]-8-oxopurin-2-yl]benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2ncn(-c3ncc4c(n3)n([C@@H]3CCOc5c(F)ccc(F)c53)c(=O)n4Cc3cc[n+](O)cc3)c2c1 |
| InChI | InChI=1S/C28H19F2N8O3/c29-18-2-3-19(30)25-24(18)21(7-10-41-25)38-26-23(36(28(38)39)14-16-5-8-35(40)9-6-16)13-32-27(34-26)37-15-33-20-4-1-17(12-31)11-22(20)37/h1-6,8-9,11,13,15,21,40H,7,10,14H2/q+1/t21-/m1/s1 |
| InChIKey | HZIKPEIVXGPKEB-OAQYLSRUSA-N |
| XLogP | 3.03 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|