C23H16FN7O2 — CID 59726924
9-[(4R)-7-fluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-7-methylpurin-8-one (PubChem CID 59726924) has the molecular formula C23H16FN7O2 and a molecular weight of 441.43 g/mol. Its IUPAC name is 9-[(4R)-7-fluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-7-methylpurin-8-one.
| Compound Name | 9-[(4R)-7-fluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-7-methylpurin-8-one |
|---|---|
| PubChem CID | 59726924 |
| Molecular Formula | C23H16FN7O2 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 9-[(4R)-7-fluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-7-methylpurin-8-one |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4c(n3)n([C@@H]3CCOc5cc(F)ccc53)c(=O)n4C)c2c1 |
| InChI | InChI=1S/C23H16FN7O2/c1-25-14-4-6-16-18(10-14)30(12-27-16)22-26-11-19-21(28-22)31(23(32)29(19)2)17-7-8-33-20-9-13(24)3-5-15(17)20/h3-6,9-12,17H,7-8H2,2H3/t17-/m1/s1 |
| InChIKey | HGNKCMSQBFTMQZ-QGZVFWFLSA-N |
| XLogP | 3.53 |
| TPSA | 84.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|