C24H18FN7O2 — CID 59726939
7-ethyl-9-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one (PubChem CID 59726939) has the molecular formula C24H18FN7O2 and a molecular weight of 455.45 g/mol. Its IUPAC name is 7-ethyl-9-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one.
| Compound Name | 7-ethyl-9-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one |
|---|---|
| PubChem CID | 59726939 |
| Molecular Formula | C24H18FN7O2 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 7-ethyl-9-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)purin-8-one |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4c(n3)n(C3CCOc5c(F)cccc53)c(=O)n4CC)c2c1 |
| InChI | InChI=1S/C24H18FN7O2/c1-3-30-20-12-27-23(31-13-28-17-8-7-14(26-2)11-19(17)31)29-22(20)32(24(30)33)18-9-10-34-21-15(18)5-4-6-16(21)25/h4-8,11-13,18H,3,9-10H2,1H3 |
| InChIKey | IPUIHFCWRUFTRW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|