C22H13F2N7O2 — CID 59726942
9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-7H-purin-8-one (PubChem CID 59726942) has the molecular formula C22H13F2N7O2 and a molecular weight of 445.39 g/mol. Its IUPAC name is 9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-7H-purin-8-one.
| Compound Name | 9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 59726942 |
| Molecular Formula | C22H13F2N7O2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 9-[(4R)-5,8-difluoro-3,4-dihydro-2H-chromen-4-yl]-2-(6-isocyanobenzimidazol-1-yl)-7H-purin-8-one |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4[nH]c(=O)n([C@@H]5CCOc6c(F)ccc(F)c65)c4n3)c2c1 |
| InChI | InChI=1S/C22H13F2N7O2/c1-25-11-2-5-14-17(8-11)30(10-27-14)21-26-9-15-20(29-21)31(22(32)28-15)16-6-7-33-19-13(24)4-3-12(23)18(16)19/h2-5,8-10,16H,6-7H2,(H,28,32)/t16-/m1/s1 |
| InChIKey | DDHCWRSWDVGFRK-MRXNPFEDSA-N |
| XLogP | 3.66 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|