C27H22F2N8O2 — CID 59727006
9-(5,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)-7-piperidin-4-ylpurin-8-one (PubChem CID 59727006) has the molecular formula C27H22F2N8O2 and a molecular weight of 528.52 g/mol. Its IUPAC name is 9-(5,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)-7-piperidin-4-ylpurin-8-one.
| Compound Name | 9-(5,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)-7-piperidin-4-ylpurin-8-one |
|---|---|
| PubChem CID | 59727006 |
| Molecular Formula | C27H22F2N8O2 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 9-(5,8-difluoro-3,4-dihydro-2H-chromen-4-yl)-2-(6-isocyanobenzimidazol-1-yl)-7-piperidin-4-ylpurin-8-one |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4c(n3)n(C3CCOc5c(F)ccc(F)c53)c(=O)n4C3CCNCC3)c2c1 |
| InChI | InChI=1S/C27H22F2N8O2/c1-30-15-2-5-19-21(12-15)35(14-33-19)26-32-13-22-25(34-26)37(27(38)36(22)16-6-9-31-10-7-16)20-8-11-39-24-18(29)4-3-17(28)23(20)24/h2-5,12-14,16,20,31H,6-11H2 |
| InChIKey | KEOZWDZUUWYJLT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|