C33H30F3N5O3 — CID 59727249
(2S)-1-[6-(1,3-benzodioxol-5-yl)-2-[[4-(trifluoromethyl)phenyl]methylamino]quinoline-4-carbonyl]-N'-cyclopropylpyrrolidine-2-carboximidamide (PubChem CID 59727249) has the molecular formula C33H30F3N5O3 and a molecular weight of 601.63 g/mol. Its IUPAC name is (2S)-1-[6-(1,3-benzodioxol-5-yl)-2-[[4-(trifluoromethyl)phenyl]methylamino]quinoline-4-carbonyl]-N'-cyclopropylpyrrolidine-2-carboximidamide.
| Compound Name | (2S)-1-[6-(1,3-benzodioxol-5-yl)-2-[[4-(trifluoromethyl)phenyl]methylamino]quinoline-4-carbonyl]-N'-cyclopropylpyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 59727249 |
| Molecular Formula | C33H30F3N5O3 |
| Molecular Weight | 601.63 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | (2S)-1-[6-(1,3-benzodioxol-5-yl)-2-[[4-(trifluoromethyl)phenyl]methylamino]quinoline-4-carbonyl]-N'-cyclopropylpyrrolidine-2-carboximidamide |
| SMILES | N/C(=N/C1CC1)[C@@H]1CCCN1C(=O)c1cc(NCc2ccc(C(F)(F)F)cc2)nc2ccc(-c3ccc4c(c3)OCO4)cc12 |
| InChI | InChI=1S/C33H30F3N5O3/c34-33(35,36)22-7-3-19(4-8-22)17-38-30-16-25(32(42)41-13-1-2-27(41)31(37)39-23-9-10-23)24-14-20(5-11-26(24)40-30)21-6-12-28-29(15-21)44-18-43-28/h3-8,11-12,14-16,23,27H,1-2,9-10,13,17-18H2,(H2,37,39)(H,38,40)/t27-/m0/s1 |
| InChIKey | SEWNYLFYRMNWJM-MHZLTWQESA-N |
| XLogP | 6.39 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|