C26H26ClN3O3 — CID 59727268
[6-(1,3-benzodioxol-5-yl)-2-chloroquinolin-4-yl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 59727268) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-5-yl)-2-chloroquinolin-4-yl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [6-(1,3-benzodioxol-5-yl)-2-chloroquinolin-4-yl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 59727268 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [6-(1,3-benzodioxol-5-yl)-2-chloroquinolin-4-yl]-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)nc2ccc(-c3ccc4c(c3)OCO4)cc12)N1CCC[C@H]1CN1CCCC1 |
| InChI | InChI=1S/C26H26ClN3O3/c27-25-14-21(26(31)30-11-3-4-19(30)15-29-9-1-2-10-29)20-12-17(5-7-22(20)28-25)18-6-8-23-24(13-18)33-16-32-23/h5-8,12-14,19H,1-4,9-11,15-16H2/t19-/m0/s1 |
| InChIKey | ORGSUXNGUCJCAG-IBGZPJMESA-N |
| XLogP | 4.98 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|