About 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide
1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide (PubChem CID 59727853) has the molecular formula C23H28N4O3
and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide.
Molecular Properties
| Compound Name | 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide |
| PubChem CID | 59727853 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide |
| SMILES | COc1ccnc(OC)c1CCN1CCC(n2ccc3ccc(C(N)=O)cc32)CC1 |
| InChI | InChI=1S/C23H28N4O3/c1-29-21-5-10-25-23(30-2)19(21)9-13-26-11-7-18(8-12-26)27-14-6-16-3-4-17(22(24)28)15-20(16)27/h3-6,10,14-15,18H,7-9,11-13H2,1-2H3,(H2,24,28) |
| InChIKey | FCRBJNFVCGGQPH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide?
The IUPAC name of 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide (CID 59727853) is 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide.
What is the SMILES notation for 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide?
The canonical SMILES for 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide is COc1ccnc(OC)c1CCN1CCC(n2ccc3ccc(C(N)=O)cc32)CC1.
What is the InChIKey of 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide?
The InChIKey is FCRBJNFVCGGQPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4O3/c1-29-21-5-10-25-23(30-2)19(21)9-13-26-11-7-18(8-12-26)27-14-6-16-3-4-17(22(24)28)15-20(16)27/h3-6,10,14-15,18H,7-9,11-13H2,1-2H3,(H2,24,28).
What are the key properties of 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide?
1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide has a molecular weight of 408.50 g/mol, XLogP of 3.03, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[2-(2,4-dimethoxy-3-pyridinyl)ethyl]piperidin-4-yl]indole-6-carboxamide is sourced from PubChem (CID 59727853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).