C26H34ClN3O2 — CID 59728846
2-[(1R,9aR,11aR)-5-chloro-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]-N-(6-methyl-2-pyridinyl)acetamide (PubChem CID 59728846) has the molecular formula C26H34ClN3O2 and a molecular weight of 456.03 g/mol. Its IUPAC name is 2-[(1R,9aR,11aR)-5-chloro-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]-N-(6-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-[(1R,9aR,11aR)-5-chloro-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]-N-(6-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 59728846 |
| Molecular Formula | C26H34ClN3O2 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-[(1R,9aR,11aR)-5-chloro-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]-N-(6-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1cccc(NC(=O)C[C@H]2CCC3C4CC(Cl)=C5NC(=O)CC[C@]5(C)C4CC[C@@]32C)n1 |
| InChI | InChI=1S/C26H34ClN3O2/c1-15-5-4-6-21(28-15)29-23(32)13-16-7-8-18-17-14-20(27)24-26(3,12-10-22(31)30-24)19(17)9-11-25(16,18)2/h4-6,16-19H,7-14H2,1-3H3,(H,30,31)(H,28,29,32)/t16-,17?,18?,19?,25-,26-/m1/s1 |
| InChIKey | LMKUURGDQZSLHE-YFIANPBHSA-N |
| XLogP | 5.55 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |