About 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid
3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid (PubChem CID 59729007) has the molecular formula C24H25N3O2
and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid |
| PubChem CID | 59729007 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid |
| SMILES | C/N=C(\NCCC(c1ccccc1)c1ccccc1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-25-24(27-21-14-8-13-20(17-21)23(28)29)26-16-15-22(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-14,17,22H,15-16H2,1H3,(H,28,29)(H2,25,26,27) |
| InChIKey | IRHGQJKQOKFGNT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid?
The IUPAC name of 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid (CID 59729007) is 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid.
What is the SMILES notation for 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid?
The canonical SMILES for 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid is C/N=C(\NCCC(c1ccccc1)c1ccccc1)Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid?
The InChIKey is IRHGQJKQOKFGNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3O2/c1-25-24(27-21-14-8-13-20(17-21)23(28)29)26-16-15-22(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-14,17,22H,15-16H2,1H3,(H,28,29)(H2,25,26,27).
What are the key properties of 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid?
3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid has a molecular weight of 387.48 g/mol, XLogP of 4.59, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[N-(3,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]benzoic acid is sourced from PubChem (CID 59729007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).