C23H27ClN8O3S — CID 59729321
N-(2-chloro-6-methylphenyl)-2-[[6-[4-[3-(hydroxyamino)-3-oxopropyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 59729321) has the molecular formula C23H27ClN8O3S and a molecular weight of 531.04 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[4-[3-(hydroxyamino)-3-oxopropyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[3-(hydroxyamino)-3-oxopropyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59729321 |
| Molecular Formula | C23H27ClN8O3S |
| Molecular Weight | 531.04 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[4-[3-(hydroxyamino)-3-oxopropyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)cc(N2CCN(CCC(=O)NO)CC2)n1 |
| InChI | InChI=1S/C23H27ClN8O3S/c1-14-4-3-5-16(24)21(14)29-22(34)17-13-25-23(36-17)28-18-12-19(27-15(2)26-18)32-10-8-31(9-11-32)7-6-20(33)30-35/h3-5,12-13,35H,6-11H2,1-2H3,(H,29,34)(H,30,33)(H,25,26,27,28) |
| InChIKey | CPVQCNWGDCIQEW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.04 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|