C11H21B3O9 — CID 59729683
2-[2-(1,3,2-dioxaborolan-2-yloxy)-3-[(4-methyl-1,3,2-dioxaborolan-2-yl)oxy]propoxy]-1,3,2-dioxaborinane (PubChem CID 59729683) has the molecular formula C11H21B3O9 and a molecular weight of 329.72 g/mol. Its IUPAC name is 2-[2-(1,3,2-dioxaborolan-2-yloxy)-3-[(4-methyl-1,3,2-dioxaborolan-2-yl)oxy]propoxy]-1,3,2-dioxaborinane.
| Compound Name | 2-[2-(1,3,2-dioxaborolan-2-yloxy)-3-[(4-methyl-1,3,2-dioxaborolan-2-yl)oxy]propoxy]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 59729683 |
| Molecular Formula | C11H21B3O9 |
| Molecular Weight | 329.72 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[2-(1,3,2-dioxaborolan-2-yloxy)-3-[(4-methyl-1,3,2-dioxaborolan-2-yl)oxy]propoxy]-1,3,2-dioxaborinane |
| SMILES | CC1COB(OCC(COB2OCCCO2)OB2OCCO2)O1 |
| InChI | InChI=1S/C11H21B3O9/c1-10-7-19-14(22-10)21-9-11(23-13-17-5-6-18-13)8-20-12-15-3-2-4-16-12/h10-11H,2-9H2,1H3 |
| InChIKey | WHYOBSFEDFKMDG-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.72 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|