About 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one
5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 597301) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one.
Molecular Properties
| Compound Name | 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
| PubChem CID | 597301 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCCC12CN3CN(CC(C)(C3)C1=O)C2 |
| InChI | InChI=1S/C12H20N2O/c1-3-4-12-7-13-5-11(2,10(12)15)6-14(8-12)9-13/h3-9H2,1-2H3 |
| InChIKey | UITBQMZELPAEHU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one?
The IUPAC name of 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one (CID 597301) is 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one.
What is the SMILES notation for 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one?
The canonical SMILES for 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one is CCCC12CN3CN(CC(C)(C3)C1=O)C2.
What is the InChIKey of 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one?
The InChIKey is UITBQMZELPAEHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-3-4-12-7-13-5-11(2,10(12)15)6-14(8-12)9-13/h3-9H2,1-2H3.
What are the key properties of 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one?
5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one has a molecular weight of 208.30 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one is sourced from PubChem (CID 597301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).