C25H22BrF2N2O3PS — CID 59730523
[[2-bromo-4-[(3,4-dimethyl-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 59730523) has the molecular formula C25H22BrF2N2O3PS and a molecular weight of 579.40 g/mol. Its IUPAC name is [[2-bromo-4-[(3,4-dimethyl-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(3,4-dimethyl-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 59730523 |
| Molecular Formula | C25H22BrF2N2O3PS |
| Molecular Weight | 579.40 g/mol |
| Exact Mass | 578.02 |
| IUPAC Name | [[2-bromo-4-[(3,4-dimethyl-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | Cc1ccc(N(Cc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)c2nc(-c3ccccc3)cs2)cc1C |
| InChI | InChI=1S/C25H22BrF2N2O3PS/c1-16-8-10-20(12-17(16)2)30(24-29-23(15-35-24)19-6-4-3-5-7-19)14-18-9-11-21(22(26)13-18)25(27,28)34(31,32)33/h3-13,15H,14H2,1-2H3,(H2,31,32,33) |
| InChIKey | PGRQETQALSAPMV-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.40 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|