About N-carbamothioyl-3,4-dimethylbenzamide
N-carbamothioyl-3,4-dimethylbenzamide (PubChem CID 59730537) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is N-carbamothioyl-3,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-carbamothioyl-3,4-dimethylbenzamide |
| PubChem CID | 59730537 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | N-carbamothioyl-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(N)=S)cc1C |
| InChI | InChI=1S/C10H12N2OS/c1-6-3-4-8(5-7(6)2)9(13)12-10(11)14/h3-5H,1-2H3,(H3,11,12,13,14) |
| InChIKey | UCVUQIYUZHZZEQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-carbamothioyl-3,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamothioyl-3,4-dimethylbenzamide?
The IUPAC name of N-carbamothioyl-3,4-dimethylbenzamide (CID 59730537) is N-carbamothioyl-3,4-dimethylbenzamide.
What is the SMILES notation for N-carbamothioyl-3,4-dimethylbenzamide?
The canonical SMILES for N-carbamothioyl-3,4-dimethylbenzamide is Cc1ccc(C(=O)NC(N)=S)cc1C.
What is the InChIKey of N-carbamothioyl-3,4-dimethylbenzamide?
The InChIKey is UCVUQIYUZHZZEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c1-6-3-4-8(5-7(6)2)9(13)12-10(11)14/h3-5H,1-2H3,(H3,11,12,13,14).
What are the key properties of N-carbamothioyl-3,4-dimethylbenzamide?
N-carbamothioyl-3,4-dimethylbenzamide has a molecular weight of 208.29 g/mol, XLogP of 1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamothioyl-3,4-dimethylbenzamide is sourced from PubChem (CID 59730537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).