C24H22BrF2N2Na2O7PS — CID 59730542
disodium;4-[3-[[3-bromo-4-[[2,2-dimethylpropanoyloxymethoxy(oxido)phosphoryl]-difluoromethyl]phenyl]methyl]-2-imino-1,3-thiazol-4-yl]benzoate (PubChem CID 59730542) has the molecular formula C24H22BrF2N2Na2O7PS and a molecular weight of 677.37 g/mol. Its IUPAC name is disodium;4-[3-[[3-bromo-4-[[2,2-dimethylpropanoyloxymethoxy(oxido)phosphoryl]-difluoromethyl]phenyl]methyl]-2-imino-1,3-thiazol-4-yl]benzoate.
| Compound Name | disodium;4-[3-[[3-bromo-4-[[2,2-dimethylpropanoyloxymethoxy(oxido)phosphoryl]-difluoromethyl]phenyl]methyl]-2-imino-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 59730542 |
| Molecular Formula | C24H22BrF2N2Na2O7PS |
| Molecular Weight | 677.37 g/mol |
| Exact Mass | 675.98 |
| IUPAC Name | disodium;4-[3-[[3-bromo-4-[[2,2-dimethylpropanoyloxymethoxy(oxido)phosphoryl]-difluoromethyl]phenyl]methyl]-2-imino-1,3-thiazol-4-yl]benzoate |
| SMILES | [H]/N=c1\scc(-c2ccc(C(=O)[O-])cc2)n1Cc1ccc(C(F)(F)P(=O)([O-])OCOC(=O)C(C)(C)C)c(Br)c1.[Na+].[Na+] |
| InChI | InChI=1S/C24H24BrF2N2O7PS.2Na/c1-23(2,3)21(32)35-13-36-37(33,34)24(26,27)17-9-4-14(10-18(17)25)11-29-19(12-38-22(29)28)15-5-7-16(8-6-15)20(30)31;;/h4-10,12,28H,11,13H2,1-3H3,(H,30,31)(H,33,34);;/q;2*+1/p-2/b28-22-;; |
| InChIKey | SWDUPNPDGPWYKV-XMSWGRMRSA-L |
| XLogP | -1.96 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.37 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|