About 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol
2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol (PubChem CID 59730591) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol.
Molecular Properties
| Compound Name | 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol |
| PubChem CID | 59730591 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol |
| SMILES | CC1(C)C2CC(O)C(C)(N=[N+]=[N-])C21 |
| InChI | InChI=1S/C9H15N3O/c1-8(2)5-4-6(13)9(3,7(5)8)11-12-10/h5-7,13H,4H2,1-3H3 |
| InChIKey | VNLIIIHITSLPFC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol?
The IUPAC name of 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol (CID 59730591) is 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol.
What is the SMILES notation for 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol?
The canonical SMILES for 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol is CC1(C)C2CC(O)C(C)(N=[N+]=[N-])C21.
What is the InChIKey of 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol?
The InChIKey is VNLIIIHITSLPFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-8(2)5-4-6(13)9(3,7(5)8)11-12-10/h5-7,13H,4H2,1-3H3.
What are the key properties of 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol?
2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol has a molecular weight of 181.24 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-2,6,6-trimethylbicyclo[3.1.0]hexan-3-ol is sourced from PubChem (CID 59730591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).