About [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate
[fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 59730686) has the molecular formula C18H23FN2O3P2
and a molecular weight of 396.34 g/mol. Its IUPAC name is [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
Molecular Properties
| Compound Name | [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| PubChem CID | 59730686 |
| Molecular Formula | C18H23FN2O3P2 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | CCCCCCC(=O)N1CCc2c1ccc1[nH]c(C(=O)OP(F)P)cc21 |
| InChI | InChI=1S/C18H23FN2O3P2/c1-2-3-4-5-6-17(22)21-10-9-12-13-11-15(18(23)24-26(19)25)20-14(13)7-8-16(12)21/h7-8,11,20H,2-6,9-10,25H2,1H3 |
| InChIKey | IHUKJYLXYIHPAA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate?
The IUPAC name of [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (CID 59730686) is [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
What is the SMILES notation for [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate?
The canonical SMILES for [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate is CCCCCCC(=O)N1CCc2c1ccc1[nH]c(C(=O)OP(F)P)cc21.
What is the InChIKey of [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate?
The InChIKey is IHUKJYLXYIHPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN2O3P2/c1-2-3-4-5-6-17(22)21-10-9-12-13-11-15(18(23)24-26(19)25)20-14(13)7-8-16(12)21/h7-8,11,20H,2-6,9-10,25H2,1H3.
What are the key properties of [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate?
[fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate has a molecular weight of 396.34 g/mol, XLogP of 5.26, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [fluoro(phosphanyl)phosphanyl] 6-heptanoyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate is sourced from PubChem (CID 59730686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).