C12H21N3O — CID 59730870
4-methyl-7-(methylamino)-10-methylidene-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-6-one (PubChem CID 59730870) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-methyl-7-(methylamino)-10-methylidene-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-6-one.
| Compound Name | 4-methyl-7-(methylamino)-10-methylidene-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-6-one |
|---|---|
| PubChem CID | 59730870 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-methyl-7-(methylamino)-10-methylidene-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-6-one |
| SMILES | C=C1CCC(NC)C(=O)N2C(C)CCCN12 |
| InChI | InChI=1S/C12H21N3O/c1-9-6-7-11(13-3)12(16)15-10(2)5-4-8-14(9)15/h10-11,13H,1,4-8H2,2-3H3 |
| InChIKey | IJRXXEZMGWNHPN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |