About 1-methylindole-3,7-dicarbaldehyde
1-methylindole-3,7-dicarbaldehyde (PubChem CID 59731130) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-methylindole-3,7-dicarbaldehyde.
Molecular Properties
| Compound Name | 1-methylindole-3,7-dicarbaldehyde |
| PubChem CID | 59731130 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1-methylindole-3,7-dicarbaldehyde |
| SMILES | Cn1cc(C=O)c2cccc(C=O)c21 |
| InChI | InChI=1S/C11H9NO2/c1-12-5-9(7-14)10-4-2-3-8(6-13)11(10)12/h2-7H,1H3 |
| InChIKey | LUCXRHSMHSNTAN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methylindole-3,7-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylindole-3,7-dicarbaldehyde?
The IUPAC name of 1-methylindole-3,7-dicarbaldehyde (CID 59731130) is 1-methylindole-3,7-dicarbaldehyde.
What is the SMILES notation for 1-methylindole-3,7-dicarbaldehyde?
The canonical SMILES for 1-methylindole-3,7-dicarbaldehyde is Cn1cc(C=O)c2cccc(C=O)c21.
What is the InChIKey of 1-methylindole-3,7-dicarbaldehyde?
The InChIKey is LUCXRHSMHSNTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c1-12-5-9(7-14)10-4-2-3-8(6-13)11(10)12/h2-7H,1H3.
What are the key properties of 1-methylindole-3,7-dicarbaldehyde?
1-methylindole-3,7-dicarbaldehyde has a molecular weight of 187.20 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylindole-3,7-dicarbaldehyde is sourced from PubChem (CID 59731130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).