About 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium
4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium (PubChem CID 59731687) has the molecular formula C7H7N2S+
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium.
Molecular Properties
| Compound Name | 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium |
| PubChem CID | 59731687 |
| Molecular Formula | C7H7N2S+ |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium |
| SMILES | C[n+]1cccc2ncsc21 |
| InChI | InChI=1S/C7H7N2S/c1-9-4-2-3-6-7(9)10-5-8-6/h2-5H,1H3/q+1 |
| InChIKey | NLQPQWLZWMVQGY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium?
The IUPAC name of 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium (CID 59731687) is 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium.
What is the SMILES notation for 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium?
The canonical SMILES for 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium is C[n+]1cccc2ncsc21.
What is the InChIKey of 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium?
The InChIKey is NLQPQWLZWMVQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2S/c1-9-4-2-3-6-7(9)10-5-8-6/h2-5H,1H3/q+1.
What are the key properties of 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium?
4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium has a molecular weight of 151.21 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-[1,3]thiazolo[5,4-b]pyridin-4-ium is sourced from PubChem (CID 59731687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).