About 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium
3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium (PubChem CID 59731741) has the molecular formula C7H11N2+
and a molecular weight of 123.18 g/mol. Its IUPAC name is 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium.
Molecular Properties
| Compound Name | 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium |
| PubChem CID | 59731741 |
| Molecular Formula | C7H11N2+ |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium |
| SMILES | C[n+]1c[nH]c2c1CCC2 |
| InChI | InChI=1S/C7H10N2/c1-9-5-8-6-3-2-4-7(6)9/h5H,2-4H2,1H3/p+1 |
| InChIKey | BLUUHKFIOWPMKS-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium?
The IUPAC name of 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium (CID 59731741) is 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium.
What is the SMILES notation for 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium?
The canonical SMILES for 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium is C[n+]1c[nH]c2c1CCC2.
What is the InChIKey of 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium?
The InChIKey is BLUUHKFIOWPMKS-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H10N2/c1-9-5-8-6-3-2-4-7(6)9/h5H,2-4H2,1H3/p+1.
What are the key properties of 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium?
3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium has a molecular weight of 123.18 g/mol, XLogP of 0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,4,5,6-tetrahydrocyclopenta[d]imidazol-3-ium is sourced from PubChem (CID 59731741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).