C8H17N4+ — CID 59731826
4-(3-aminopropyl)-1,2-dimethylpyrazol-2-ium-5-amine (PubChem CID 59731826) has the molecular formula C8H17N4+ and a molecular weight of 169.25 g/mol. Its IUPAC name is 4-(3-aminopropyl)-1,2-dimethylpyrazol-2-ium-5-amine.
| Compound Name | 4-(3-aminopropyl)-1,2-dimethylpyrazol-2-ium-5-amine |
|---|---|
| PubChem CID | 59731826 |
| Molecular Formula | C8H17N4+ |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.14 |
| IUPAC Name | 4-(3-aminopropyl)-1,2-dimethylpyrazol-2-ium-5-amine |
| SMILES | Cn1c(N)c(CCCN)c[n+]1C |
| InChI | InChI=1S/C8H16N4/c1-11-6-7(4-3-5-9)8(10)12(11)2/h6,10H,3-5,9H2,1-2H3/p+1 |
| InChIKey | WZOHTUGEICVZBX-UHFFFAOYSA-O |
| XLogP | -0.68 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|