About 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one
2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one (PubChem CID 59731888) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one |
| PubChem CID | 59731888 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one |
| SMILES | O=C1Cc2ccccc2CN1C1CCNCC1 |
| InChI | InChI=1S/C14H18N2O/c17-14-9-11-3-1-2-4-12(11)10-16(14)13-5-7-15-8-6-13/h1-4,13,15H,5-10H2 |
| InChIKey | OFGRIUZKFDDZPU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one?
The IUPAC name of 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one (CID 59731888) is 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one.
What is the SMILES notation for 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one?
The canonical SMILES for 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one is O=C1Cc2ccccc2CN1C1CCNCC1.
What is the InChIKey of 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one?
The InChIKey is OFGRIUZKFDDZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c17-14-9-11-3-1-2-4-12(11)10-16(14)13-5-7-15-8-6-13/h1-4,13,15H,5-10H2.
What are the key properties of 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one?
2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one has a molecular weight of 230.31 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-1,4-dihydroisoquinolin-3-one is sourced from PubChem (CID 59731888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).