C17H18F3N3O3 — CID 59731895
methyl 2-[(7S)-4-methyl-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[5,4-i][2]benzazepin-7-yl]acetate (PubChem CID 59731895) has the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. Its IUPAC name is methyl 2-[(7S)-4-methyl-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[5,4-i][2]benzazepin-7-yl]acetate.
| Compound Name | methyl 2-[(7S)-4-methyl-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[5,4-i][2]benzazepin-7-yl]acetate |
|---|---|
| PubChem CID | 59731895 |
| Molecular Formula | C17H18F3N3O3 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | methyl 2-[(7S)-4-methyl-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[5,4-i][2]benzazepin-7-yl]acetate |
| SMILES | COC(=O)C[C@@H]1Cc2cc(C)c3[nH]ncc3c2CN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C17H18F3N3O3/c1-9-3-10-4-11(5-14(24)26-2)16(25)23(8-17(18,19)20)7-13(10)12-6-21-22-15(9)12/h3,6,11H,4-5,7-8H2,1-2H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | HQWDZGQVAPUAKS-NSHDSACASA-N |
| XLogP | 2.50 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |