C19H22F3N3O3 — CID 59732016
methyl 2-[(7S)-8-oxo-4-propan-2-yl-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]acetate (PubChem CID 59732016) has the molecular formula C19H22F3N3O3 and a molecular weight of 397.40 g/mol. Its IUPAC name is methyl 2-[(7S)-8-oxo-4-propan-2-yl-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]acetate.
| Compound Name | methyl 2-[(7S)-8-oxo-4-propan-2-yl-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]acetate |
|---|---|
| PubChem CID | 59732016 |
| Molecular Formula | C19H22F3N3O3 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | methyl 2-[(7S)-8-oxo-4-propan-2-yl-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]acetate |
| SMILES | COC(=O)C[C@@H]1Cc2cc(C(C)C)c3[nH]ncc3c2CN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C19H22F3N3O3/c1-10(2)13-5-11-4-12(6-16(26)28-3)18(27)25(9-19(20,21)22)8-15(11)14-7-23-24-17(13)14/h5,7,10,12H,4,6,8-9H2,1-3H3,(H,23,24)/t12-/m0/s1 |
| InChIKey | VNMZCBNMDSATOT-LBPRGKRZSA-N |
| XLogP | 3.31 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |