C15H13ClF3N3O3 — CID 59732027
2-[(7S)-4-chloro-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]acetic acid (PubChem CID 59732027) has the molecular formula C15H13ClF3N3O3 and a molecular weight of 375.73 g/mol. Its IUPAC name is 2-[(7S)-4-chloro-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]acetic acid.
| Compound Name | 2-[(7S)-4-chloro-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]acetic acid |
|---|---|
| PubChem CID | 59732027 |
| Molecular Formula | C15H13ClF3N3O3 |
| Molecular Weight | 375.73 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-[(7S)-4-chloro-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1Cc2cc(Cl)c3[nH]ncc3c2CN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C15H13ClF3N3O3/c16-11-2-7-1-8(3-12(23)24)14(25)22(6-15(17,18)19)5-10(7)9-4-20-21-13(9)11/h2,4,8H,1,3,5-6H2,(H,20,21)(H,23,24)/t8-/m0/s1 |
| InChIKey | CDMSEVFXYQUTEW-QMMMGPOBSA-N |
| XLogP | 2.75 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |